C16H24O7 — CID 10568265
[(3aS,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooct-7-enoate (PubChem CID 10568265) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is [(3aS,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooct-7-enoate.
| Compound Name | [(3aS,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooct-7-enoate |
|---|---|
| PubChem CID | 10568265 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(3aS,6S,6aS)-6-hydroxy-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-3a-yl]methyl 3-oxooct-7-enoate |
| SMILES | C=CCCCC(=O)CC(=O)OC[C@@]12OC[C@H](O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C16H24O7/c1-4-5-6-7-11(17)8-13(19)20-10-16-14(12(18)9-21-16)22-15(2,3)23-16/h4,12,14,18H,1,5-10H2,2-3H3/t12-,14-,16-/m0/s1 |
| InChIKey | DACYDRAUPDGALD-NOLJZWGESA-N |
| XLogP | 1.08 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|