C13H20O7 — CID 10541336
[(2R,3S,4S)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxooct-7-enoate (PubChem CID 10541336) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is [(2R,3S,4S)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxooct-7-enoate.
| Compound Name | [(2R,3S,4S)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxooct-7-enoate |
|---|---|
| PubChem CID | 10541336 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [(2R,3S,4S)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxooct-7-enoate |
| SMILES | C=CCCCC(=O)CC(=O)OC[C@@]1(O)OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H20O7/c1-2-3-4-5-9(14)6-11(16)19-8-13(18)12(17)10(15)7-20-13/h2,10,12,15,17-18H,1,3-8H2/t10-,12-,13+/m0/s1 |
| InChIKey | BDKNMFNBUXOTHN-WCFLWFBJSA-N |
| XLogP | -0.71 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|