C15H24O7 — CID 10615312
[(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxodec-9-enoate (PubChem CID 10615312) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxodec-9-enoate.
| Compound Name | [(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxodec-9-enoate |
|---|---|
| PubChem CID | 10615312 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(2R,3S,4R)-2,3,4-trihydroxyoxolan-2-yl]methyl 3-oxodec-9-enoate |
| SMILES | C=CCCCCCC(=O)CC(=O)OC[C@@]1(O)OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H24O7/c1-2-3-4-5-6-7-11(16)8-13(18)21-10-15(20)14(19)12(17)9-22-15/h2,12,14,17,19-20H,1,3-10H2/t12-,14+,15-/m1/s1 |
| InChIKey | KAEKLKAVQNTWRU-VHDGCEQUSA-N |
| XLogP | 0.07 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|