C17H15ClN2O3S — CID 10570673
3-(3-oxo-1,2-benzothiazol-2-yl)propyl N-(3-chlorophenyl)carbamate (PubChem CID 10570673) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is 3-(3-oxo-1,2-benzothiazol-2-yl)propyl N-(3-chlorophenyl)carbamate.
| Compound Name | 3-(3-oxo-1,2-benzothiazol-2-yl)propyl N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 10570673 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-(3-oxo-1,2-benzothiazol-2-yl)propyl N-(3-chlorophenyl)carbamate |
| SMILES | O=C(Nc1cccc(Cl)c1)OCCCn1sc2ccccc2c1=O |
| InChI | InChI=1S/C17H15ClN2O3S/c18-12-5-3-6-13(11-12)19-17(22)23-10-4-9-20-16(21)14-7-1-2-8-15(14)24-20/h1-3,5-8,11H,4,9-10H2,(H,19,22) |
| InChIKey | MUELGJWYYHAFTG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|