C18H15N5O4 — CID 10570836
methyl 2-(1-benzyl-4-methyl-9-oxoimidazo[1,2-a]purin-7-yl)-2-oxoacetate (PubChem CID 10570836) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is methyl 2-(1-benzyl-4-methyl-9-oxoimidazo[1,2-a]purin-7-yl)-2-oxoacetate.
| Compound Name | methyl 2-(1-benzyl-4-methyl-9-oxoimidazo[1,2-a]purin-7-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 10570836 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | methyl 2-(1-benzyl-4-methyl-9-oxoimidazo[1,2-a]purin-7-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1cnc2n(C)c3ncn(Cc4ccccc4)c3c(=O)n12 |
| InChI | InChI=1S/C18H15N5O4/c1-21-15-13(22(10-20-15)9-11-6-4-3-5-7-11)16(25)23-12(8-19-18(21)23)14(24)17(26)27-2/h3-8,10H,9H2,1-2H3 |
| InChIKey | WFCUILHETYCBAN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|