C19H24O6S — CID 10571823
methyl (1S,2S,4S,5S,7R)-2,7-dimethyl-4-(4-methylphenyl)sulfonyloxy-8-oxobicyclo[3.2.1]octane-1-carboxylate (PubChem CID 10571823) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is methyl (1S,2S,4S,5S,7R)-2,7-dimethyl-4-(4-methylphenyl)sulfonyloxy-8-oxobicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1S,2S,4S,5S,7R)-2,7-dimethyl-4-(4-methylphenyl)sulfonyloxy-8-oxobicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 10571823 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | methyl (1S,2S,4S,5S,7R)-2,7-dimethyl-4-(4-methylphenyl)sulfonyloxy-8-oxobicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)[C@@H](C[C@H]1C)[C@@H](OS(=O)(=O)c1ccc(C)cc1)C[C@@H]2C |
| InChI | InChI=1S/C19H24O6S/c1-11-5-7-14(8-6-11)26(22,23)25-16-10-13(3)19(18(21)24-4)12(2)9-15(16)17(19)20/h5-8,12-13,15-16H,9-10H2,1-4H3/t12-,13+,15+,16+,19+/m1/s1 |
| InChIKey | NTZLRBGDTAYQSP-VOCSUFDSSA-N |
| XLogP | 2.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|