C18H20ClNO8 — CID 10573800
(7R,12aS)-3-methoxy-7-methyl-5,6,12,12a-tetrahydroindolo[2,1-a]isoquinolin-7-ium-2,9,10-triol perchlorate (PubChem CID 10573800) has the molecular formula C18H20ClNO8 and a molecular weight of 413.81 g/mol. Its IUPAC name is (7R,12aS)-3-methoxy-7-methyl-5,6,12,12a-tetrahydroindolo[2,1-a]isoquinolin-7-ium-2,9,10-triol perchlorate.
| Compound Name | (7R,12aS)-3-methoxy-7-methyl-5,6,12,12a-tetrahydroindolo[2,1-a]isoquinolin-7-ium-2,9,10-triol perchlorate |
|---|---|
| PubChem CID | 10573800 |
| Molecular Formula | C18H20ClNO8 |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (7R,12aS)-3-methoxy-7-methyl-5,6,12,12a-tetrahydroindolo[2,1-a]isoquinolin-7-ium-2,9,10-triol perchlorate |
| SMILES | COc1cc2c(cc1O)[C@@H]1Cc3cc(O)c(O)cc3[N@+]1(C)CC2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H19NO4.ClHO4/c1-19-4-3-10-7-18(23-2)17(22)8-12(10)14(19)5-11-6-15(20)16(21)9-13(11)19;2-1(3,4)5/h6-9,14H,3-5H2,1-2H3,(H2-,20,21,22);(H,2,3,4,5)/t14-,19-;/m0./s1 |
| InChIKey | BSYIKDMCJIYRKR-JPJJPTBZSA-N |
| XLogP | -2.15 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|