C15H19N+ — CID 10575973
CID 10575973 (PubChem CID 10575973) has the molecular formula C15H19N+ and a molecular weight of 213.32 g/mol.
| Compound Name | CID 10575973 |
|---|---|
| PubChem CID | 10575973 |
| Molecular Formula | C15H19N+ |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | — |
| SMILES | C=C1/C(=C\[C]2[CH][CH][CH][CH]2)[N+]2(C)CCC1CC2 |
| InChI | InChI=1S/C15H19N/c1-12-14-7-9-16(2,10-8-14)15(12)11-13-5-3-4-6-13/h3-6,11,14H,1,7-10H2,2H3/q+1/b15-11+ |
| InChIKey | JIOCAVSVVCDLTQ-RVDMUPIBSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|