C30H30NO6P — CID 10578167
(2S)-3-dibenzofuran-3-yl-2-[[(1R)-1-dimethoxyphosphoryl-3-naphthalen-1-ylpropyl]amino]propanoic acid (PubChem CID 10578167) has the molecular formula C30H30NO6P and a molecular weight of 531.55 g/mol. Its IUPAC name is (2S)-3-dibenzofuran-3-yl-2-[[(1R)-1-dimethoxyphosphoryl-3-naphthalen-1-ylpropyl]amino]propanoic acid.
| Compound Name | (2S)-3-dibenzofuran-3-yl-2-[[(1R)-1-dimethoxyphosphoryl-3-naphthalen-1-ylpropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10578167 |
| Molecular Formula | C30H30NO6P |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (2S)-3-dibenzofuran-3-yl-2-[[(1R)-1-dimethoxyphosphoryl-3-naphthalen-1-ylpropyl]amino]propanoic acid |
| SMILES | COP(=O)(OC)[C@H](CCc1cccc2ccccc12)N[C@@H](Cc1ccc2c(c1)oc1ccccc12)C(=O)O |
| InChI | InChI=1S/C30H30NO6P/c1-35-38(34,36-2)29(17-15-22-10-7-9-21-8-3-4-11-23(21)22)31-26(30(32)33)18-20-14-16-25-24-12-5-6-13-27(24)37-28(25)19-20/h3-14,16,19,26,29,31H,15,17-18H2,1-2H3,(H,32,33)/t26-,29+/m0/s1 |
| InChIKey | XIIIEFCKSGJMNE-LITSAYRRSA-N |
| XLogP | 6.77 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|