C29H34NO8P — CID 10578679
methyl (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoate (PubChem CID 10578679) has the molecular formula C29H34NO8P and a molecular weight of 555.56 g/mol. Its IUPAC name is methyl (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoate.
| Compound Name | methyl (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoate |
|---|---|
| PubChem CID | 10578679 |
| Molecular Formula | C29H34NO8P |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | methyl (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc2c(c1)oc1ccccc12)N[C@H](CCc1ccc(OC)c(OC)c1)P(=O)(OC)OC |
| InChI | InChI=1S/C29H34NO8P/c1-33-25-14-11-19(17-27(25)34-2)12-15-28(39(32,36-4)37-5)30-23(29(31)35-3)16-20-10-13-22-21-8-6-7-9-24(21)38-26(22)18-20/h6-11,13-14,17-18,23,28,30H,12,15-16H2,1-5H3/t23-,28-/m0/s1 |
| InChIKey | QWXXJTULCRQIAK-FIPFOOKPSA-N |
| XLogP | 5.72 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|