C28H32NO8P — CID 10816302
(2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoic acid (PubChem CID 10816302) has the molecular formula C28H32NO8P and a molecular weight of 541.54 g/mol. Its IUPAC name is (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoic acid.
| Compound Name | (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10816302 |
| Molecular Formula | C28H32NO8P |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (2S)-3-dibenzofuran-3-yl-2-[[(1S)-3-(3,4-dimethoxyphenyl)-1-dimethoxyphosphorylpropyl]amino]propanoic acid |
| SMILES | COc1ccc(CC[C@@H](N[C@@H](Cc2ccc3c(c2)oc2ccccc23)C(=O)O)P(=O)(OC)OC)cc1OC |
| InChI | InChI=1S/C28H32NO8P/c1-33-24-13-10-18(16-26(24)34-2)11-14-27(38(32,35-3)36-4)29-22(28(30)31)15-19-9-12-21-20-7-5-6-8-23(20)37-25(21)17-19/h5-10,12-13,16-17,22,27,29H,11,14-15H2,1-4H3,(H,30,31)/t22-,27-/m0/s1 |
| InChIKey | LFCUGIGWJVQAFM-CUNXSJBXSA-N |
| XLogP | 5.63 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|