C18H19N2O7P — CID 10645007
2-[[(2S)-3-dibenzofuran-3-yl-2-(phosphonomethylamino)propanoyl]amino]acetic acid (PubChem CID 10645007) has the molecular formula C18H19N2O7P and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-[[(2S)-3-dibenzofuran-3-yl-2-(phosphonomethylamino)propanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-3-dibenzofuran-3-yl-2-(phosphonomethylamino)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 10645007 |
| Molecular Formula | C18H19N2O7P |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[[(2S)-3-dibenzofuran-3-yl-2-(phosphonomethylamino)propanoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)[C@H](Cc1ccc2c(c1)oc1ccccc12)NCP(=O)(O)O |
| InChI | InChI=1S/C18H19N2O7P/c21-17(22)9-19-18(23)14(20-10-28(24,25)26)7-11-5-6-13-12-3-1-2-4-15(12)27-16(13)8-11/h1-6,8,14,20H,7,9-10H2,(H,19,23)(H,21,22)(H2,24,25,26)/t14-/m0/s1 |
| InChIKey | JHWQHWQWPOUPOL-AWEZNQCLSA-N |
| XLogP | 1.42 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|