C29H34NO9P — CID 10745655
(2S)-3-dibenzofuran-3-yl-2-[[(1S)-1-dimethoxyphosphoryl-3-(3,4,5-trimethoxyphenyl)propyl]amino]propanoic acid (PubChem CID 10745655) has the molecular formula C29H34NO9P and a molecular weight of 571.56 g/mol. Its IUPAC name is (2S)-3-dibenzofuran-3-yl-2-[[(1S)-1-dimethoxyphosphoryl-3-(3,4,5-trimethoxyphenyl)propyl]amino]propanoic acid.
| Compound Name | (2S)-3-dibenzofuran-3-yl-2-[[(1S)-1-dimethoxyphosphoryl-3-(3,4,5-trimethoxyphenyl)propyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10745655 |
| Molecular Formula | C29H34NO9P |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | (2S)-3-dibenzofuran-3-yl-2-[[(1S)-1-dimethoxyphosphoryl-3-(3,4,5-trimethoxyphenyl)propyl]amino]propanoic acid |
| SMILES | COc1cc(CC[C@@H](N[C@@H](Cc2ccc3c(c2)oc2ccccc23)C(=O)O)P(=O)(OC)OC)cc(OC)c1OC |
| InChI | InChI=1S/C29H34NO9P/c1-34-25-16-19(17-26(35-2)28(25)36-3)11-13-27(40(33,37-4)38-5)30-22(29(31)32)14-18-10-12-21-20-8-6-7-9-23(20)39-24(21)15-18/h6-10,12,15-17,22,27,30H,11,13-14H2,1-5H3,(H,31,32)/t22-,27-/m0/s1 |
| InChIKey | KIBOXXUWZGRIDQ-CUNXSJBXSA-N |
| XLogP | 5.64 |
| TPSA | 125.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|