C16H22Cl2S8 — CID 10578404
2-[4,5-bis(4-chlorobutylsulfanyl)-1,3-dithiol-2-ylidene]-4,5-bis(methylsulfanyl)-1,3-dithiole (PubChem CID 10578404) has the molecular formula C16H22Cl2S8 and a molecular weight of 541.79 g/mol. Its IUPAC name is 2-[4,5-bis(4-chlorobutylsulfanyl)-1,3-dithiol-2-ylidene]-4,5-bis(methylsulfanyl)-1,3-dithiole.
| Compound Name | 2-[4,5-bis(4-chlorobutylsulfanyl)-1,3-dithiol-2-ylidene]-4,5-bis(methylsulfanyl)-1,3-dithiole |
|---|---|
| PubChem CID | 10578404 |
| Molecular Formula | C16H22Cl2S8 |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 539.89 |
| IUPAC Name | 2-[4,5-bis(4-chlorobutylsulfanyl)-1,3-dithiol-2-ylidene]-4,5-bis(methylsulfanyl)-1,3-dithiole |
| SMILES | CSC1=C(SC)SC(=C2SC(SCCCCCl)=C(SCCCCCl)S2)S1 |
| InChI | InChI=1S/C16H22Cl2S8/c1-19-11-12(20-2)24-15(23-11)16-25-13(21-9-5-3-7-17)14(26-16)22-10-6-4-8-18/h3-10H2,1-2H3 |
| InChIKey | SMKPDGGBTJGLJM-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|