C45H86O8 — CID 10580943
(2E,6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10-triene-1,15,19,23,27,31,34,35-octol (PubChem CID 10580943) has the molecular formula C45H86O8 and a molecular weight of 755.17 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10-triene-1,15,19,23,27,31,34,35-octol.
| Compound Name | (2E,6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10-triene-1,15,19,23,27,31,34,35-octol |
|---|---|
| PubChem CID | 10580943 |
| Molecular Formula | C45H86O8 |
| Molecular Weight | 755.17 g/mol |
| Exact Mass | 754.63 |
| IUPAC Name | (2E,6E,10E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10-triene-1,15,19,23,27,31,34,35-octol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CC/C=C(\C)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC(O)C(C)(C)O |
| InChI | InChI=1S/C45H86O8/c1-36(19-12-21-38(3)24-35-46)18-11-20-37(2)22-13-25-41(6,49)26-14-27-42(7,50)28-15-29-43(8,51)30-16-31-44(9,52)32-17-33-45(10,53)34-23-39(47)40(4,5)48/h19-20,24,39,46-53H,11-18,21-23,25-35H2,1-10H3/b36-19+,37-20+,38-24+ |
| InChIKey | OTYYBSNNSCTJCO-WXNAAJQBSA-N |
| XLogP | 8.90 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.17 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|