C10H16O6S — CID 10587688
[(2R,3R)-3-acetyloxy-2-acetylsulfanyl-4-hydroxybutyl] acetate (PubChem CID 10587688) has the molecular formula C10H16O6S and a molecular weight of 264.30 g/mol. Its IUPAC name is [(2R,3R)-3-acetyloxy-2-acetylsulfanyl-4-hydroxybutyl] acetate.
| Compound Name | [(2R,3R)-3-acetyloxy-2-acetylsulfanyl-4-hydroxybutyl] acetate |
|---|---|
| PubChem CID | 10587688 |
| Molecular Formula | C10H16O6S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [(2R,3R)-3-acetyloxy-2-acetylsulfanyl-4-hydroxybutyl] acetate |
| SMILES | CC(=O)OC[C@@H](SC(C)=O)[C@@H](CO)OC(C)=O |
| InChI | InChI=1S/C10H16O6S/c1-6(12)15-5-10(17-8(3)14)9(4-11)16-7(2)13/h9-11H,4-5H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | LSFKCSAHUHBEAY-NXEZZACHSA-N |
| XLogP | 0.12 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|