C18H36O2Si — CID 10591245
triethyl-[(5E)-2-propan-2-yloxynona-1,5-dien-4-yl]oxysilane (PubChem CID 10591245) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is triethyl-[(5E)-2-propan-2-yloxynona-1,5-dien-4-yl]oxysilane.
| Compound Name | triethyl-[(5E)-2-propan-2-yloxynona-1,5-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 10591245 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | triethyl-[(5E)-2-propan-2-yloxynona-1,5-dien-4-yl]oxysilane |
| SMILES | C=C(CC(/C=C/CCC)O[Si](CC)(CC)CC)OC(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-8-12-13-14-18(15-17(7)19-16(5)6)20-21(9-2,10-3)11-4/h13-14,16,18H,7-12,15H2,1-6H3/b14-13+ |
| InChIKey | MKESZQPXNRWJMQ-BUHFOSPRSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|