C28H27NO4 — CID 10599279
(4R,5S)-4,5-diphenyl-3-[(3R,4R,5R)-4-(phenylmethoxymethyl)-1-oxaspiro[2.3]hexan-5-yl]-1,3-oxazolidin-2-one (PubChem CID 10599279) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (4R,5S)-4,5-diphenyl-3-[(3R,4R,5R)-4-(phenylmethoxymethyl)-1-oxaspiro[2.3]hexan-5-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4,5-diphenyl-3-[(3R,4R,5R)-4-(phenylmethoxymethyl)-1-oxaspiro[2.3]hexan-5-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10599279 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (4R,5S)-4,5-diphenyl-3-[(3R,4R,5R)-4-(phenylmethoxymethyl)-1-oxaspiro[2.3]hexan-5-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1[C@@H]1C[C@]2(CO2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C28H27NO4/c30-27-29(24-16-28(19-32-28)23(24)18-31-17-20-10-4-1-5-11-20)25(21-12-6-2-7-13-21)26(33-27)22-14-8-3-9-15-22/h1-15,23-26H,16-19H2/t23-,24+,25+,26-,28-/m0/s1 |
| InChIKey | BRCISEKZVRDPLZ-QXQSRQBGSA-N |
| XLogP | 5.30 |
| TPSA | 51.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|