C31H45NO5Si — CID 10602518
(4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]hexanoyl]-1,3-oxazolidin-2-one (PubChem CID 10602518) has the molecular formula C31H45NO5Si and a molecular weight of 539.79 g/mol. Its IUPAC name is (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]hexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]hexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10602518 |
| Molecular Formula | C31H45NO5Si |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | (4R)-4-benzhydryl-3-[(2R)-2-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]hexanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCC[C@@H](C(=O)N1C(=O)OC[C@H]1C(c1ccccc1)c1ccccc1)[C@@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H45NO5Si/c1-8-9-20-25(28(33)22(2)37-38(6,7)31(3,4)5)29(34)32-26(21-36-30(32)35)27(23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,22,25-28,33H,8-9,20-21H2,1-7H3/t22-,25-,26+,28+/m1/s1 |
| InChIKey | BPJGHYLUHSOUSA-JAHYEJHYSA-N |
| XLogP | 6.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|