C27H34F5NO6Si — CID 10603524
(2,3,4,5,6-pentafluorophenyl) (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 10603524) has the molecular formula C27H34F5NO6Si and a molecular weight of 591.65 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 10603524 |
| Molecular Formula | C27H34F5NO6Si |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-(4-hydroxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H](C(=O)Oc1c(F)c(F)c(F)c(F)c1F)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H34F5NO6Si/c1-26(2,3)38-25(36)33(7)21(24(35)37-23-19(31)17(29)16(28)18(30)20(23)32)22(14-10-12-15(34)13-11-14)39-40(8,9)27(4,5)6/h10-13,21-22,34H,1-9H3/t21-,22-/m0/s1 |
| InChIKey | HTWUKXUJZNACQE-VXKWHMMOSA-N |
| XLogP | 6.99 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|