C34H58O8 — CID 10603582
(5S)-3-[8-hydroxy-12-[2-(2-undec-2-ynoxyethoxy)ethoxy]dodec-10-ynyl]-4-(methoxymethoxy)-5-methyloxolan-2-one (PubChem CID 10603582) has the molecular formula C34H58O8 and a molecular weight of 594.83 g/mol. Its IUPAC name is (5S)-3-[8-hydroxy-12-[2-(2-undec-2-ynoxyethoxy)ethoxy]dodec-10-ynyl]-4-(methoxymethoxy)-5-methyloxolan-2-one.
| Compound Name | (5S)-3-[8-hydroxy-12-[2-(2-undec-2-ynoxyethoxy)ethoxy]dodec-10-ynyl]-4-(methoxymethoxy)-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 10603582 |
| Molecular Formula | C34H58O8 |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | (5S)-3-[8-hydroxy-12-[2-(2-undec-2-ynoxyethoxy)ethoxy]dodec-10-ynyl]-4-(methoxymethoxy)-5-methyloxolan-2-one |
| SMILES | CCCCCCCCC#CCOCCOCCOCC#CCC(O)CCCCCCCC1C(=O)O[C@@H](C)C1OCOC |
| InChI | InChI=1S/C34H58O8/c1-4-5-6-7-8-9-10-14-18-23-38-25-27-40-28-26-39-24-19-17-21-31(35)20-15-12-11-13-16-22-32-33(41-29-37-3)30(2)42-34(32)36/h30-33,35H,4-13,15-16,20-29H2,1-3H3/t30-,31?,32?,33?/m0/s1 |
| InChIKey | DFOWZPLEVZLODT-IMDVACINSA-N |
| XLogP | 5.83 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|