C21H37NO6 — CID 53381130
[(2R,3S,6S,7R,8R)-3-amino-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 4-methylpentanoate (PubChem CID 53381130) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is [(2R,3S,6S,7R,8R)-3-amino-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 4-methylpentanoate.
| Compound Name | [(2R,3S,6S,7R,8R)-3-amino-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 53381130 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | [(2R,3S,6S,7R,8R)-3-amino-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 4-methylpentanoate |
| SMILES | CCCCCC[C@H]1C(=O)O[C@H](C)[C@H](N)C(=O)O[C@@H](C)[C@@H]1OC(=O)CCC(C)C |
| InChI | InChI=1S/C21H37NO6/c1-6-7-8-9-10-16-19(28-17(23)12-11-13(2)3)15(5)27-21(25)18(22)14(4)26-20(16)24/h13-16,18-19H,6-12,22H2,1-5H3/t14-,15+,16-,18+,19+/m1/s1 |
| InChIKey | SLJNRKSIWHDUJF-LHHMMCJZSA-N |
| XLogP | 3.13 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|