C10H18N4 — CID 106043175
N'-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methylpropanimidamide (PubChem CID 106043175) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methylpropanimidamide.
| Compound Name | N'-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 106043175 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | N'-[(1,5-dimethylpyrazol-4-yl)methyl]-2-methylpropanimidamide |
| SMILES | Cc1c(C/N=C(/N)C(C)C)cnn1C |
| InChI | InChI=1S/C10H18N4/c1-7(2)10(11)12-5-9-6-13-14(4)8(9)3/h6-7H,5H2,1-4H3,(H2,11,12) |
| InChIKey | JFPGWJLOUQOALT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|