C16H26Cl2Si — CID 10615418
[4-tert-butyl-2,6-bis(chloromethyl)phenyl]methyl-trimethylsilane (PubChem CID 10615418) has the molecular formula C16H26Cl2Si and a molecular weight of 317.38 g/mol. Its IUPAC name is [4-tert-butyl-2,6-bis(chloromethyl)phenyl]methyl-trimethylsilane.
| Compound Name | [4-tert-butyl-2,6-bis(chloromethyl)phenyl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10615418 |
| Molecular Formula | C16H26Cl2Si |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [4-tert-butyl-2,6-bis(chloromethyl)phenyl]methyl-trimethylsilane |
| SMILES | CC(C)(C)c1cc(CCl)c(C[Si](C)(C)C)c(CCl)c1 |
| InChI | InChI=1S/C16H26Cl2Si/c1-16(2,3)14-7-12(9-17)15(11-19(4,5)6)13(8-14)10-18/h7-8H,9-11H2,1-6H3 |
| InChIKey | ZTPPVJKFVOKSOQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|