C10H12F3N3O4S — CID 106209125
ethyl 5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 106209125) has the molecular formula C10H12F3N3O4S and a molecular weight of 327.28 g/mol. Its IUPAC name is ethyl 5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 106209125 |
| Molecular Formula | C10H12F3N3O4S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | ethyl 5-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F3N3O4S/c1-2-20-8(17)6-5-14-15-7(6)21(18,19)16-9(3-4-9)10(11,12)13/h5,16H,2-4H2,1H3,(H,14,15) |
| InChIKey | POXQIVKLRHDCLY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |