C14H21N6O6P — CID 10620980
[(2R,4R)-4-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid (PubChem CID 10620980) has the molecular formula C14H21N6O6P and a molecular weight of 400.33 g/mol. Its IUPAC name is [(2R,4R)-4-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid.
| Compound Name | [(2R,4R)-4-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 10620980 |
| Molecular Formula | C14H21N6O6P |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(2R,4R)-4-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-N-(1-methoxy-1-oxopropan-2-yl)phosphonamidic acid |
| SMILES | COC(=O)C(C)NP(=O)(O)OC[C@H]1C[C@@H](n2cnc3c(N)ncnc32)CO1 |
| InChI | InChI=1S/C14H21N6O6P/c1-8(14(21)24-2)19-27(22,23)26-5-10-3-9(4-25-10)20-7-18-11-12(15)16-6-17-13(11)20/h6-10H,3-5H2,1-2H3,(H2,15,16,17)(H2,19,22,23)/t8?,9-,10-/m1/s1 |
| InChIKey | PYVQKRNZHKYLJH-VXRWAFEHSA-N |
| XLogP | 0.01 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|