C18H11N7O5 — CID 10621288
ethyl 2,2,8-tricyano-7-(4-nitrophenyl)-5-oxo-1,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate (PubChem CID 10621288) has the molecular formula C18H11N7O5 and a molecular weight of 405.33 g/mol. Its IUPAC name is ethyl 2,2,8-tricyano-7-(4-nitrophenyl)-5-oxo-1,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate.
| Compound Name | ethyl 2,2,8-tricyano-7-(4-nitrophenyl)-5-oxo-1,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 10621288 |
| Molecular Formula | C18H11N7O5 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | ethyl 2,2,8-tricyano-7-(4-nitrophenyl)-5-oxo-1,3-dihydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc([N+](=O)[O-])cc2)c(C#N)c2n(c1=O)NC(C#N)(C#N)N2 |
| InChI | InChI=1S/C18H11N7O5/c1-2-30-17(27)14-13(10-3-5-11(6-4-10)25(28)29)12(7-19)15-22-18(8-20,9-21)23-24(15)16(14)26/h3-6,22-23H,2H2,1H3 |
| InChIKey | YBCFVPWAROBMRQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 186.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|