C17H26N2 — CID 106223790
1-hex-1-yn-3-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine (PubChem CID 106223790) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-hex-1-yn-3-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 1-hex-1-yn-3-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 106223790 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-hex-1-yn-3-yl-2,6,6-trimethyl-5,7-dihydro-4H-indol-4-amine |
| SMILES | C#CC(CCC)n1c(C)cc2c1CC(C)(C)CC2N |
| InChI | InChI=1S/C17H26N2/c1-6-8-13(7-2)19-12(3)9-14-15(18)10-17(4,5)11-16(14)19/h2,9,13,15H,6,8,10-11,18H2,1,3-5H3 |
| InChIKey | NPMLBBAKIYQMJT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|