C17H28F2N5O4P — CID 10622749
1-(7-diethoxyphosphoryl-7,7-difluoroheptyl)-4-methoxypyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 10622749) has the molecular formula C17H28F2N5O4P and a molecular weight of 435.41 g/mol. Its IUPAC name is 1-(7-diethoxyphosphoryl-7,7-difluoroheptyl)-4-methoxypyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 1-(7-diethoxyphosphoryl-7,7-difluoroheptyl)-4-methoxypyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 10622749 |
| Molecular Formula | C17H28F2N5O4P |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-(7-diethoxyphosphoryl-7,7-difluoroheptyl)-4-methoxypyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCCCCCn1ncc2c(OC)nc(N)nc21 |
| InChI | InChI=1S/C17H28F2N5O4P/c1-4-27-29(25,28-5-2)17(18,19)10-8-6-7-9-11-24-14-13(12-21-24)15(26-3)23-16(20)22-14/h12H,4-11H2,1-3H3,(H2,20,22,23) |
| InChIKey | YLTBVGRVNKSSMD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|