C31H35NO3 — CID 10624170
[(1R,2S,5R)-5-methyl-2-(2-naphthalen-2-ylpropan-2-yl)cyclohexyl] (Z)-2-benzamidobut-2-enoate (PubChem CID 10624170) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-(2-naphthalen-2-ylpropan-2-yl)cyclohexyl] (Z)-2-benzamidobut-2-enoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-(2-naphthalen-2-ylpropan-2-yl)cyclohexyl] (Z)-2-benzamidobut-2-enoate |
|---|---|
| PubChem CID | 10624170 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-(2-naphthalen-2-ylpropan-2-yl)cyclohexyl] (Z)-2-benzamidobut-2-enoate |
| SMILES | C/C=C(\NC(=O)c1ccccc1)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H35NO3/c1-5-27(32-29(33)23-12-7-6-8-13-23)30(34)35-28-19-21(2)15-18-26(28)31(3,4)25-17-16-22-11-9-10-14-24(22)20-25/h5-14,16-17,20-21,26,28H,15,18-19H2,1-4H3,(H,32,33)/b27-5-/t21-,26-,28-/m1/s1 |
| InChIKey | GXKAFJGLKPWXML-ZJONZOBMSA-N |
| XLogP | 6.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|