C10H19N3O2S — CID 106315277
1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperazine (PubChem CID 106315277) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperazine.
| Compound Name | 1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperazine |
|---|---|
| PubChem CID | 106315277 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]piperazine |
| SMILES | CC1=CCCN(S(=O)(=O)N2CCNCC2)C1 |
| InChI | InChI=1S/C10H19N3O2S/c1-10-3-2-6-13(9-10)16(14,15)12-7-4-11-5-8-12/h3,11H,2,4-9H2,1H3 |
| InChIKey | KPIUGJXXTRFCPV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|