C11H24Br2Si — CID 106324319
[2,2-bis(bromomethyl)-4-methylpentyl]-trimethylsilane (PubChem CID 106324319) has the molecular formula C11H24Br2Si and a molecular weight of 344.21 g/mol. Its IUPAC name is [2,2-bis(bromomethyl)-4-methylpentyl]-trimethylsilane.
| Compound Name | [2,2-bis(bromomethyl)-4-methylpentyl]-trimethylsilane |
|---|---|
| PubChem CID | 106324319 |
| Molecular Formula | C11H24Br2Si |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | [2,2-bis(bromomethyl)-4-methylpentyl]-trimethylsilane |
| SMILES | CC(C)CC(CBr)(CBr)C[Si](C)(C)C |
| InChI | InChI=1S/C11H24Br2Si/c1-10(2)6-11(7-12,8-13)9-14(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | DIFXKWMOKBDHPB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|