C11H17BrO — CID 10634083
(8Z,10E)-11-bromoundeca-8,10-dien-5-one (PubChem CID 10634083) has the molecular formula C11H17BrO and a molecular weight of 245.16 g/mol. Its IUPAC name is (8Z,10E)-11-bromoundeca-8,10-dien-5-one.
| Compound Name | (8Z,10E)-11-bromoundeca-8,10-dien-5-one |
|---|---|
| PubChem CID | 10634083 |
| Molecular Formula | C11H17BrO |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (8Z,10E)-11-bromoundeca-8,10-dien-5-one |
| SMILES | CCCCC(=O)CC/C=C\C=C\Br |
| InChI | InChI=1S/C11H17BrO/c1-2-3-8-11(13)9-6-4-5-7-10-12/h4-5,7,10H,2-3,6,8-9H2,1H3/b5-4-,10-7+ |
| InChIKey | ZSMIDWIAVJNQGM-DOIONKORSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|