About methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate
methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate (PubChem CID 106394089) has the molecular formula C10H11N3O4
and a molecular weight of 237.22 g/mol. Its IUPAC name is methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate |
| PubChem CID | 106394089 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNCc2ncon2)c1 |
| InChI | InChI=1S/C10H11N3O4/c1-15-10(14)7-2-8(16-5-7)3-11-4-9-12-6-17-13-9/h2,5-6,11H,3-4H2,1H3 |
| InChIKey | AIPLPCDSIMMEAL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate?
The IUPAC name of methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate (CID 106394089) is methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate.
What is the SMILES notation for methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate?
The canonical SMILES for methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate is COC(=O)c1coc(CNCc2ncon2)c1.
What is the InChIKey of methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate?
The InChIKey is AIPLPCDSIMMEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O4/c1-15-10(14)7-2-8(16-5-7)3-11-4-9-12-6-17-13-9/h2,5-6,11H,3-4H2,1H3.
What are the key properties of methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate?
methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate has a molecular weight of 237.22 g/mol, XLogP of 0.74, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]furan-3-carboxylate is sourced from PubChem (CID 106394089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).