C22H36O3 — CID 10641481
2,4-ditert-butyl-4-tert-butylperoxy-6-(2-methylprop-1-enyl)cyclohexa-2,5-dien-1-one (PubChem CID 10641481) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2,4-ditert-butyl-4-tert-butylperoxy-6-(2-methylprop-1-enyl)cyclohexa-2,5-dien-1-one.
| Compound Name | 2,4-ditert-butyl-4-tert-butylperoxy-6-(2-methylprop-1-enyl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10641481 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 2,4-ditert-butyl-4-tert-butylperoxy-6-(2-methylprop-1-enyl)cyclohexa-2,5-dien-1-one |
| SMILES | CC(C)=CC1=CC(OOC(C)(C)C)(C(C)(C)C)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C22H36O3/c1-15(2)12-16-13-22(20(6,7)8,25-24-21(9,10)11)14-17(18(16)23)19(3,4)5/h12-14H,1-11H3 |
| InChIKey | BZSZZQLMVARAET-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|