C18H23NO3SSi — CID 10642353
4-[ethenyl(dimethyl)silyl]-2-(4-methylphenyl)sulfonyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one (PubChem CID 10642353) has the molecular formula C18H23NO3SSi and a molecular weight of 361.54 g/mol. Its IUPAC name is 4-[ethenyl(dimethyl)silyl]-2-(4-methylphenyl)sulfonyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one.
| Compound Name | 4-[ethenyl(dimethyl)silyl]-2-(4-methylphenyl)sulfonyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 10642353 |
| Molecular Formula | C18H23NO3SSi |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-[ethenyl(dimethyl)silyl]-2-(4-methylphenyl)sulfonyl-1,3,6,6a-tetrahydrocyclopenta[c]pyrrol-5-one |
| SMILES | C=C[Si](C)(C)C1=C2CN(S(=O)(=O)c3ccc(C)cc3)CC2CC1=O |
| InChI | InChI=1S/C18H23NO3SSi/c1-5-24(3,4)18-16-12-19(11-14(16)10-17(18)20)23(21,22)15-8-6-13(2)7-9-15/h5-9,14H,1,10-12H2,2-4H3 |
| InChIKey | ATNPOTBIALLKLJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|