C12H18N8O — CID 106424786
4-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 106424786) has the molecular formula C12H18N8O and a molecular weight of 290.33 g/mol. Its IUPAC name is 4-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 106424786 |
| Molecular Formula | C12H18N8O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(NCc2ccno2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H18N8O/c13-19-11-16-10(14-8-9-4-5-15-21-9)17-12(18-11)20-6-2-1-3-7-20/h4-5H,1-3,6-8,13H2,(H2,14,16,17,18,19) |
| InChIKey | PNDOJTFIZVDMJH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|