C11H17N3O2S — CID 106435320
1-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]imidazolidin-2-one (PubChem CID 106435320) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]imidazolidin-2-one.
| Compound Name | 1-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 106435320 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-[2-[(2-hydroxy-2-thiophen-3-ylethyl)amino]ethyl]imidazolidin-2-one |
| SMILES | O=C1NCCN1CCNCC(O)c1ccsc1 |
| InChI | InChI=1S/C11H17N3O2S/c15-10(9-1-6-17-8-9)7-12-2-4-14-5-3-13-11(14)16/h1,6,8,10,12,15H,2-5,7H2,(H,13,16) |
| InChIKey | GRIUKOQPHABTLT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|