C9H6Cl2O4S — CID 106435658
(E)-3-(2,5-dichlorophenyl)sulfonylprop-2-enoic acid (PubChem CID 106435658) has the molecular formula C9H6Cl2O4S and a molecular weight of 281.12 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)sulfonylprop-2-enoic acid.
| Compound Name | (E)-3-(2,5-dichlorophenyl)sulfonylprop-2-enoic acid |
|---|---|
| PubChem CID | 106435658 |
| Molecular Formula | C9H6Cl2O4S |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)sulfonylprop-2-enoic acid |
| SMILES | O=C(O)/C=C/S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H6Cl2O4S/c10-6-1-2-7(11)8(5-6)16(14,15)4-3-9(12)13/h1-5H,(H,12,13)/b4-3+ |
| InChIKey | OMXMBCWBQMMQRM-ONEGZZNKSA-N |
| XLogP | 2.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|