C28H27NO3 — CID 10646058
(4R,5S)-3-[(1R,2R)-3-methylidene-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 10646058) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (4R,5S)-3-[(1R,2R)-3-methylidene-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(1R,2R)-3-methylidene-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10646058 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (4R,5S)-3-[(1R,2R)-3-methylidene-2-(phenylmethoxymethyl)cyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C=C1C[C@@H](N2C(=O)O[C@@H](c3ccccc3)[C@H]2c2ccccc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C28H27NO3/c1-20-17-25(24(20)19-31-18-21-11-5-2-6-12-21)29-26(22-13-7-3-8-14-22)27(32-28(29)30)23-15-9-4-10-16-23/h2-16,24-27H,1,17-19H2/t24-,25-,26-,27+/m1/s1 |
| InChIKey | LUZCWFLRWZNYHE-CWTOASCOSA-N |
| XLogP | 6.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|