C14H26BrN5O — CID 106462644
1-(5-bromo-3-methyltriazol-4-yl)-N-ethyl-2-methyl-2-morpholin-4-ylbutan-1-amine (PubChem CID 106462644) has the molecular formula C14H26BrN5O and a molecular weight of 360.30 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-N-ethyl-2-methyl-2-morpholin-4-ylbutan-1-amine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-ethyl-2-methyl-2-morpholin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 106462644 |
| Molecular Formula | C14H26BrN5O |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-N-ethyl-2-methyl-2-morpholin-4-ylbutan-1-amine |
| SMILES | CCNC(c1c(Br)nnn1C)C(C)(CC)N1CCOCC1 |
| InChI | InChI=1S/C14H26BrN5O/c1-5-14(3,20-7-9-21-10-8-20)12(16-6-2)11-13(15)17-18-19(11)4/h12,16H,5-10H2,1-4H3 |
| InChIKey | CRQGAHQNNZTFBB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |