C24H44O5Si — CID 10646784
[(1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-yl] acetate (PubChem CID 10646784) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is [(1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-yl] acetate.
| Compound Name | [(1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-yl] acetate |
|---|---|
| PubChem CID | 10646784 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | [(1E,3S,4E,6R)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]undeca-1,4-dien-3-yl] acetate |
| SMILES | CCCCC[C@H](/C=C/[C@H](/C=C/[C@H]1COC(C)(C)O1)OC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O5Si/c1-10-11-12-13-21(29-30(8,9)23(3,4)5)16-14-20(27-19(2)25)15-17-22-18-26-24(6,7)28-22/h14-17,20-22H,10-13,18H2,1-9H3/b16-14+,17-15+/t20-,21-,22+/m1/s1 |
| InChIKey | QRUZVPRMDKLPHL-CQWJAKNCSA-N |
| XLogP | 6.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|