C24H24ClNO5S2 — CID 10649235
N-(4,5-dimethyl-2-thianthren-5-ium-5-ylphenyl)-N-ethylacetamide perchlorate (PubChem CID 10649235) has the molecular formula C24H24ClNO5S2 and a molecular weight of 506.05 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-thianthren-5-ium-5-ylphenyl)-N-ethylacetamide perchlorate.
| Compound Name | N-(4,5-dimethyl-2-thianthren-5-ium-5-ylphenyl)-N-ethylacetamide perchlorate |
|---|---|
| PubChem CID | 10649235 |
| Molecular Formula | C24H24ClNO5S2 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | N-(4,5-dimethyl-2-thianthren-5-ium-5-ylphenyl)-N-ethylacetamide perchlorate |
| SMILES | CCN(C(C)=O)c1cc(C)c(C)cc1[S+]1c2ccccc2Sc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H24NOS2.ClHO4/c1-5-25(18(4)26)19-14-16(2)17(3)15-24(19)28-22-12-8-6-10-20(22)27-21-11-7-9-13-23(21)28;2-1(3,4)5/h6-15H,5H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | YPCZCRYUSZHGIT-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 112.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|