C13H19NO — CID 177233677
1-(N-ethyl-2,4,5-trimethylanilino)ethenol (PubChem CID 177233677) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(N-ethyl-2,4,5-trimethylanilino)ethenol.
| Compound Name | 1-(N-ethyl-2,4,5-trimethylanilino)ethenol |
|---|---|
| PubChem CID | 177233677 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(N-ethyl-2,4,5-trimethylanilino)ethenol |
| SMILES | C=C(O)N(CC)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C13H19NO/c1-6-14(12(5)15)13-8-10(3)9(2)7-11(13)4/h7-8,15H,5-6H2,1-4H3 |
| InChIKey | ZBERFMUCZSVJPP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|