C15H16N4O2 — CID 106539080
6,7-dimethoxy-N-(1-methylpyrazol-3-yl)isoquinolin-1-amine (PubChem CID 106539080) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 6,7-dimethoxy-N-(1-methylpyrazol-3-yl)isoquinolin-1-amine.
| Compound Name | 6,7-dimethoxy-N-(1-methylpyrazol-3-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 106539080 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 6,7-dimethoxy-N-(1-methylpyrazol-3-yl)isoquinolin-1-amine |
| SMILES | COc1cc2ccnc(Nc3ccn(C)n3)c2cc1OC |
| InChI | InChI=1S/C15H16N4O2/c1-19-7-5-14(18-19)17-15-11-9-13(21-3)12(20-2)8-10(11)4-6-16-15/h4-9H,1-3H3,(H,16,17,18) |
| InChIKey | MVXNKKIYWZVHKK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |