C10H16O2 — CID 10654675
(5R,6R,8S)-6,8-dimethyl-1,10-dioxaspiro[4.5]dec-2-ene (PubChem CID 10654675) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (5R,6R,8S)-6,8-dimethyl-1,10-dioxaspiro[4.5]dec-2-ene.
| Compound Name | (5R,6R,8S)-6,8-dimethyl-1,10-dioxaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 10654675 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (5R,6R,8S)-6,8-dimethyl-1,10-dioxaspiro[4.5]dec-2-ene |
| SMILES | C[C@@H]1CO[C@@]2(CC=CO2)[C@H](C)C1 |
| InChI | InChI=1S/C10H16O2/c1-8-6-9(2)10(12-7-8)4-3-5-11-10/h3,5,8-9H,4,6-7H2,1-2H3/t8-,9+,10-/m0/s1 |
| InChIKey | DILJQYLPVYNTPU-AEJSXWLSSA-N |
| XLogP | 2.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |