C16H16N2O2 — CID 10659530
N,N-dimethyl-3-oxo-2-phenyl-3-pyridin-2-ylpropanamide (PubChem CID 10659530) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N,N-dimethyl-3-oxo-2-phenyl-3-pyridin-2-ylpropanamide.
| Compound Name | N,N-dimethyl-3-oxo-2-phenyl-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 10659530 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N,N-dimethyl-3-oxo-2-phenyl-3-pyridin-2-ylpropanamide |
| SMILES | CN(C)C(=O)C(C(=O)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-18(2)16(20)14(12-8-4-3-5-9-12)15(19)13-10-6-7-11-17-13/h3-11,14H,1-2H3 |
| InChIKey | BWBWBYDLQPGDNT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|