C13H10N6O2 — CID 10660519
3-[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-1-yl]propanenitrile (PubChem CID 10660519) has the molecular formula C13H10N6O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-1-yl]propanenitrile.
| Compound Name | 3-[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 10660519 |
| Molecular Formula | C13H10N6O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[5-[(1,3-dioxoisoindol-2-yl)methyl]tetrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1nnnc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10N6O2/c14-6-3-7-19-11(15-16-17-19)8-18-12(20)9-4-1-2-5-10(9)13(18)21/h1-2,4-5H,3,7-8H2 |
| InChIKey | GIXPKJJQKSWTBQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 104.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|