C13H13F5N2O2S2 — CID 10667991
3-(2-ethylsulfonylethyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-2-imine (PubChem CID 10667991) has the molecular formula C13H13F5N2O2S2 and a molecular weight of 388.38 g/mol. Its IUPAC name is 3-(2-ethylsulfonylethyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-2-imine.
| Compound Name | 3-(2-ethylsulfonylethyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 10667991 |
| Molecular Formula | C13H13F5N2O2S2 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 3-(2-ethylsulfonylethyl)-6-(1,1,2,2,2-pentafluoroethyl)-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(C(F)(F)C(F)(F)F)ccc2n1CCS(=O)(=O)CC |
| InChI | InChI=1S/C13H13F5N2O2S2/c1-2-24(21,22)6-5-20-9-4-3-8(7-10(9)23-11(20)19)12(14,15)13(16,17)18/h3-4,7,19H,2,5-6H2,1H3/b19-11- |
| InChIKey | ZVNNIQQEEIPQLY-ODLFYWEKSA-N |
| XLogP | 3.27 |
| TPSA | 62.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|