C9H9ClN2OS — CID 768948
2-(6-chloro-2-imino-1,3-benzothiazol-3-yl)ethanol (PubChem CID 768948) has the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. Its IUPAC name is 2-(6-chloro-2-imino-1,3-benzothiazol-3-yl)ethanol.
| Compound Name | 2-(6-chloro-2-imino-1,3-benzothiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 768948 |
| Molecular Formula | C9H9ClN2OS |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 2-(6-chloro-2-imino-1,3-benzothiazol-3-yl)ethanol |
| SMILES | [H]/N=c1\sc2cc(Cl)ccc2n1CCO |
| InChI | InChI=1S/C9H9ClN2OS/c10-6-1-2-7-8(5-6)14-9(11)12(7)3-4-13/h1-2,5,11,13H,3-4H2/b11-9- |
| InChIKey | UJAATLNBACNRMJ-LUAWRHEFSA-N |
| XLogP | 1.83 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |